Name | 6-(hydroxymethyl)-6,10,17,17,20,22,23-heptamethyl-2-oxapentacyclo[12.7.1.1³,¹¹.0⁵,¹⁰.0¹⁵,²⁰]tricos-14-en-7-ol |
Wikidata | Q105248645 |
Mol. formula | C30H50O3 |
CAS registry number | - |
Mol. weight | 458.7173 |
Temporary LOTUS id | LTS0146669 |
Name | 6-(hydroxymethyl)-6,10,17,17,20,22,23-heptamethyl-2-oxapentacyclo[12.7.1.1³,¹¹.0⁵,¹⁰.0¹⁵,²⁰]tricos-14-en-7-ol |
Canonical SMILES | CC1C2=C3CC(C)(C)CCC3(C)CC1OC1CC3C(C)(CO)C(O)CCC3(C)C(CC2)C1C |
2D SMILES | CC1C2=C3CC(C)(C)CCC3(C)CC1OC1CC3C(C)(CO)C(O)CCC3(C)C(CC2)C1C |
IUPAC name | 6-(hydroxymethyl)-6,10,17,17,20,22,23-heptamethyl-2-oxapentacyclo[12.7.1.1³,¹¹.0⁵,¹⁰.0¹⁵,²⁰]tricos-14-en-7-ol |
InChI | InChI=1S/C30H50O3/c1-18-20-8-9-21-19(2)23(14-25-29(21,6)11-10-26(32)30(25,7)17-31)33-24(18)16-28(5)13-12-27(3,4)15-22(20)28/h18-19,21,23-26,31-32H,8-17H2,1-7H3 |
InChIKey | RZWDOQONUGCDNA-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C2CC(=C3CCCCC3C2)CCC4CC1CC5CCCCC45 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Oleanane triterpenoids |
Total atom number | 83 |
Heavy atom number | 33 |
Bond count | 37 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1 |
Alogp | 5.71 |
Alogp2 | 32.57 |
Apol | 88.5457 |
Bpol | 56.5763 |
EccentricConnectivityIndexDescriptor | 669 |
FmfDescriptor | 0.697 |
Fsp3 | 0.9333 |
FragmentComplexityDescriptor | 6513.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2649 |
Xlogp | 7.195 |
ZagrebIndex | 198 |
TopoPSA | 49.69 |