Name | (9s)-4,5,15,16-tetramethoxy-10,10-dimethyl-10-azatetracyclo[7.7.1.0²,⁷.0¹³,¹⁷]heptadeca-1(16),2(7),3,5,13(17),14-hexaen-10-ium |
Wikidata | Q74417240 |
Mol. formula | [C22H28NO4]+ |
CAS registry number | - |
Mol. weight | 370.4629 |
Temporary LOTUS id | LTS0145962 |
Name | (9s)-4,5,15,16-tetramethoxy-10,10-dimethyl-10-azatetracyclo[7.7.1.0²,⁷.0¹³,¹⁷]heptadeca-1(16),2(7),3,5,13(17),14-hexaen-10-ium |
Canonical SMILES | COc1cc2c(cc1OC)-c1c(OC)c(OC)cc3c1[C@H](C2)[N+](C)(C)CC3 |
2D SMILES | COc1cc2c(cc1OC)-c1c(OC)c(OC)cc3c1C(C2)[N+](C)(C)CC3 |
IUPAC name | (9S)-4,5,15,16-tetramethoxy-10,10-dimethyl-10-azatetracyclo[7.7.1.0²,⁷.0¹³,¹⁷]heptadeca-1(16),2(7),3,5,13(17),14-hexaen-10-ium |
InChI | InChI=1S/C22H28NO4/c1-23(2)8-7-13-10-19(26-5)22(27-6)21-15-12-18(25-4)17(24-3)11-14(15)9-16(23)20(13)21/h10-12,16H,7-9H2,1-6H3/q+1/t16-/m0/s1 |
InChIKey | WKHHFWJJIRCXHA-INIZCTEOSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)-c3cccc4c3C(NCC4)C2 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 55 |
Heavy atom number | 27 |
Bond count | 30 |
Number of carbons | 22 |
Minimal number of rings | 4 |
Maximal number of rings | 12 |
NP-likeness score | 1 |
Alogp | 2.18 |
Alogp2 | 4.75 |
Apol | 61.6982 |
Bpol | 40.9138 |
EccentricConnectivityIndexDescriptor | 457 |
FmfDescriptor | 0.6296 |
Fsp3 | 0.4545 |
FragmentComplexityDescriptor | 2662.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1548 |
Xlogp | 2.709 |
ZagrebIndex | 152 |
TopoPSA | 36.92 |