Name | Dihydroxy acetone |
Wikidata | Q105276520 |
Mol. formula | C3H6O3 |
CAS registry number | - |
Mol. weight | 90.0781 |
Temporary LOTUS id | LTS0145601 |
Name | Dihydroxy acetone |
Canonical SMILES | CC(=O)C(O)O |
2D SMILES | CC(=O)C(O)O |
IUPAC name | 1,1-dihydroxypropan-2-one |
InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h3,5-6H,1H3 |
InChIKey | UOQFZGVGGMHGEE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Carbohydrates | Saccharides | Monosaccharides |
Total atom number | 12 |
Heavy atom number | 6 |
Bond count | 5 |
Number of carbons | 3 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.08 |
Alogp | -1.04 |
Alogp2 | 1.09 |
Apol | 11.6868 |
Bpol | 7.5172 |
EccentricConnectivityIndexDescriptor | 24 |
FmfDescriptor | 0 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 91.03 |
PetitjeanNumber | 0.3333 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 29 |
Xlogp | -1.321 |
ZagrebIndex | 22 |
TopoPSA | 57.53 |