Name | (4s,4ar,7s,7as)-7a-hydroxy-2,4,7-trimethyl-hexahydro-1h-cyclopenta[c]pyridin-2-ium-2-olate |
Wikidata | Q105309190 |
Mol. formula | C11H21NO2 |
CAS registry number | - |
Mol. weight | 199.2904 |
Temporary LOTUS id | LTS0142766 |
Name | (4s,4ar,7s,7as)-7a-hydroxy-2,4,7-trimethyl-hexahydro-1h-cyclopenta[c]pyridin-2-ium-2-olate |
Canonical SMILES | C[C@@H]1C[N+](C)([O-])C[C@]2(O)[C@@H](C)CC[C@H]12 |
2D SMILES | CC1C[N+](C)([O-])CC2(O)C(C)CCC12 |
IUPAC name | (4S,4aR,7S,7aS)-7a-hydroxy-2,4,7-trimethyl-octahydro-1H-cyclopenta[c]pyridin-2-ium-2-olate |
InChI | InChI=1S/C11H21NO2/c1-8-6-12(3,14)7-11(13)9(2)4-5-10(8)11/h8-10,13H,4-7H2,1-3H3/t8-,9+,10-,11+,12?/m1/s1 |
InChIKey | WNNYIIINIZJRMW-OGZKGVCFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N1CCC2CCCC2C1 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 35 |
Heavy atom number | 14 |
Bond count | 15 |
Number of carbons | 11 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.57 |
Alogp | 1.18 |
Alogp2 | 1.39 |
Apol | 36.0667 |
Bpol | 25.2353 |
EccentricConnectivityIndexDescriptor | 126 |
FmfDescriptor | 0.6429 |
Fsp3 | 1 |
FragmentComplexityDescriptor | 1114.03 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 253 |
Xlogp | 0.542 |
ZagrebIndex | 80 |
TopoPSA | 43.29 |