Name | Helilandin b |
Wikidata | Q76386743 |
Mol. formula | C18H18O5 |
CAS registry number | - |
Mol. weight | 314.3332 |
Temporary LOTUS id | LTS0142457 |
Name | Helilandin b |
Canonical SMILES | COc1cc(O)c(C(=O)/C=C/c2ccccc2)c(OC)c1OC |
2D SMILES | COc1cc(O)c(C(=O)C=Cc2ccccc2)c(OC)c1OC |
IUPAC name | (2E)-1-(6-hydroxy-2,3,4-trimethoxyphenyl)-3-phenylprop-2-en-1-one |
InChI | InChI=1S/C18H18O5/c1-21-15-11-14(20)16(18(23-3)17(15)22-2)13(19)10-9-12-7-5-4-6-8-12/h4-11,20H,1-3H3/b10-9+ |
InChIKey | PSHNFUINYKNYTK-MDZDMXLPSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C=CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Chalcones |
Total atom number | 41 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.02 |
Alogp | 3.39 |
Alogp2 | 11.46 |
Apol | 47.6923 |
Bpol | 26.3837 |
EccentricConnectivityIndexDescriptor | 436 |
FmfDescriptor | 0.6522 |
Fsp3 | 0.1667 |
FragmentComplexityDescriptor | 1258.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1220 |
Xlogp | 3.348 |
ZagrebIndex | 112 |
TopoPSA | 64.99 |