Name | (1r,2s,4as,5's,8as)-2,5,5,5',8a-pentamethyl-hexahydro-2h-spiro[naphthalene-1,2'-oxolan]-5'-ylacetic acid |
Wikidata | Q105186288 |
Mol. formula | C20H34O3 |
CAS registry number | - |
Mol. weight | 322.4829 |
Temporary LOTUS id | LTS0142021 |
Name | (1r,2s,4as,5's,8as)-2,5,5,5',8a-pentamethyl-hexahydro-2h-spiro[naphthalene-1,2'-oxolan]-5'-ylacetic acid |
Canonical SMILES | C[C@H]1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@@]12CC[C@@](C)(CC(=O)O)O2 |
2D SMILES | CC1CCC2C(C)(C)CCCC2(C)C12CCC(C)(CC(=O)O)O2 |
IUPAC name | 2-[(1R,2S,4aS,5'S,8aS)-2,5,5,5',8a-pentamethyl-octahydro-2H-spiro[naphthalene-1,2'-oxolan]-5'-yl]acetic acid |
InChI | InChI=1S/C20H34O3/c1-14-7-8-15-17(2,3)9-6-10-19(15,5)20(14)12-11-18(4,23-20)13-16(21)22/h14-15H,6-13H2,1-5H3,(H,21,22)/t14-,15-,18-,19-,20+/m0/s1 |
InChIKey | NVLJYZLKNZPYEN-HVXNZKGKSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCCC12CCCC3CCCCC32 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Labdane diterpenoids |
Total atom number | 57 |
Heavy atom number | 23 |
Bond count | 25 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.41 |
Alogp | 4.33 |
Alogp2 | 18.72 |
Apol | 60.277 |
Bpol | 40.043 |
EccentricConnectivityIndexDescriptor | 344 |
FmfDescriptor | 0.6087 |
Fsp3 | 0.95 |
FragmentComplexityDescriptor | 2975.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1011 |
Xlogp | 5.751 |
ZagrebIndex | 134 |
TopoPSA | 46.53 |