Name | 2-{[(2-hydroxyphenyl)methoxy]methyl}phenol |
Wikidata | Q82022832 |
Mol. formula | C14H14O3 |
CAS registry number | - |
Mol. weight | 230.2597 |
Temporary LOTUS id | LTS0140714 |
Name | 2-{[(2-hydroxyphenyl)methoxy]methyl}phenol |
Canonical SMILES | Oc1ccccc1COCc1ccccc1O |
2D SMILES | Oc1ccccc1COCc1ccccc1O |
IUPAC name | 2-{[(2-hydroxyphenyl)methoxy]methyl}phenol |
InChI | InChI=1S/C14H14O3/c15-13-7-3-1-5-11(13)9-17-10-12-6-2-4-8-14(12)16/h1-8,15-16H,9-10H2 |
InChIKey | PLNNBRYFKARCEV-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(Cc1ccccc1)Cc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Polyketides | | | | |
Total atom number | 31 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 14 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 2.68 |
Alogp2 | 7.2 |
Apol | 36.3811 |
Bpol | 17.2209 |
EccentricConnectivityIndexDescriptor | 286 |
FmfDescriptor | 0.8824 |
Fsp3 | 0.1429 |
FragmentComplexityDescriptor | 752.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 588 |
Xlogp | 2.628 |
ZagrebIndex | 82 |
TopoPSA | 49.69 |