Name | (4ar,5s,6r,8as)-8a-[(acetyloxy)methyl]-5-[2-(furan-3-yl)ethyl]-5,6-dimethyl-4a,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
Wikidata | Q104946108 |
Mol. formula | C22H28O5 |
CAS registry number | - |
Mol. weight | 372.4556 |
Temporary LOTUS id | LTS0140469 |
Name | (4ar,5s,6r,8as)-8a-[(acetyloxy)methyl]-5-[2-(furan-3-yl)ethyl]-5,6-dimethyl-4a,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
Canonical SMILES | CC(=O)OC[C@@]12CC[C@@H](C)[C@](C)(CCc3ccoc3)[C@H]1C=CC=C2C(=O)O |
2D SMILES | CC(=O)OCC12CCC(C)C(C)(CCc3ccoc3)C1C=CC=C2C(=O)O |
IUPAC name | (4aR,5S,6R,8aS)-8a-[(acetyloxy)methyl]-5-[2-(furan-3-yl)ethyl]-5,6-dimethyl-4a,5,6,7,8,8a-hexahydronaphthalene-1-carboxylic acid |
InChI | InChI=1S/C22H28O5/c1-15-7-11-22(14-27-16(2)23)18(20(24)25)5-4-6-19(22)21(15,3)10-8-17-9-12-26-13-17/h4-6,9,12-13,15,19H,7-8,10-11,14H2,1-3H3,(H,24,25)/t15-,19-,21+,22-/m1/s1 |
InChIKey | BUIGVZOGLRDZCC-SPPOGVHBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1ccc(c1)CCC2CCCC3C=CC=CC32 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Halimane diterpenoids |
Total atom number | 55 |
Heavy atom number | 27 |
Bond count | 29 |
Number of carbons | 22 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.39 |
Alogp | 3.71 |
Alogp2 | 13.76 |
Apol | 61.4002 |
Bpol | 36.3578 |
EccentricConnectivityIndexDescriptor | 482 |
FmfDescriptor | 0.6296 |
Fsp3 | 0.5455 |
FragmentComplexityDescriptor | 2547.05 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1677 |
Xlogp | 4.321 |
ZagrebIndex | 144 |
TopoPSA | 76.74 |