Name | (2r,3s)-4-[(1r,7as)-hexahydro-1h-pyrrolizin-1-ylmethoxy]-3-hydroxy-3-methyl-4-oxobutan-2-yl (2e)-2-methylbut-2-enoate |
Wikidata | Q105229263 |
Mol. formula | C18H29NO5 |
CAS registry number | - |
Mol. weight | 339.4273 |
Temporary LOTUS id | LTS0139699 |
Name | (2r,3s)-4-[(1r,7as)-hexahydro-1h-pyrrolizin-1-ylmethoxy]-3-hydroxy-3-methyl-4-oxobutan-2-yl (2e)-2-methylbut-2-enoate |
Canonical SMILES | C/C=C(\C)C(=O)O[C@H](C)[C@](C)(O)C(=O)OC[C@@H]1CCN2CCC[C@@H]12 |
2D SMILES | CC=C(C)C(=O)OC(C)C(C)(O)C(=O)OCC1CCN2CCCC12 |
IUPAC name | (2R,3S)-4-{[(1R,7aS)-hexahydro-1H-pyrrolizin-1-yl]methoxy}-3-hydroxy-3-methyl-4-oxobutan-2-yl (2E)-2-methylbut-2-enoate |
InChI | InChI=1S/C18H29NO5/c1-5-12(2)16(20)24-13(3)18(4,22)17(21)23-11-14-8-10-19-9-6-7-15(14)19/h5,13-15,22H,6-11H2,1-4H3/b12-5+/t13-,14+,15+,18+/m1/s1 |
InChIKey | QWLVLKBPONBFQZ-BPIFGQDUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N12CCCC1CCC2 |
Pathway | Superclass | Class |
Alkaloids | Ornithine alkaloids | Pyrrolizidine alkaloids |
Total atom number | 53 |
Heavy atom number | 24 |
Bond count | 25 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.39 |
Alogp | 2.29 |
Alogp2 | 5.23 |
Apol | 56.127 |
Bpol | 39.431 |
EccentricConnectivityIndexDescriptor | 502 |
FmfDescriptor | 0.3333 |
Fsp3 | 0.7778 |
FragmentComplexityDescriptor | 2364.06 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1473 |
Xlogp | 1.681 |
ZagrebIndex | 122 |
TopoPSA | 76.07 |