Name | (3as,5ar,6s)-3a-(hydroxymethyl)-1-(1-hydroxypropan-2-yl)-6-methoxy-5a-methyl-2h,3h,4h,5h,6h,7h-cyclohepta[e]indene-8-carbaldehyde |
Wikidata | Q77510277 |
Mol. formula | C21H30O4 |
CAS registry number | - |
Mol. weight | 346.4613 |
Temporary LOTUS id | LTS0139646 |
Name | (3as,5ar,6s)-3a-(hydroxymethyl)-1-(1-hydroxypropan-2-yl)-6-methoxy-5a-methyl-2h,3h,4h,5h,6h,7h-cyclohepta[e]indene-8-carbaldehyde |
Canonical SMILES | CO[C@H]1CC(C=O)=CC=C2C3=C(C(C)CO)CC[C@]3(CO)CC[C@]21C |
2D SMILES | COC1CC(C=O)=CC=C2C3=C(C(C)CO)CCC3(CO)CCC21C |
IUPAC name | (3aS,5aR,6S)-3a-(hydroxymethyl)-1-(1-hydroxypropan-2-yl)-6-methoxy-5a-methyl-2H,3H,3aH,4H,5H,5aH,6H,7H-cyclohepta[e]indene-8-carbaldehyde |
InChI | InChI=1S/C21H30O4/c1-14(11-22)16-6-7-21(13-24)9-8-20(2)17(19(16)21)5-4-15(12-23)10-18(20)25-3/h4-5,12,14,18,22,24H,6-11,13H2,1-3H3/t14?,18-,20+,21+/m0/s1 |
InChIKey | YNWVJYUTUMCIQZ-ISGZNDKYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C=1C=C2C3=CCCC3CCC2CCC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Sesquiterpenoids|Diterpenoids | |Cyathane diterpenoids |
Total atom number | 55 |
Heavy atom number | 25 |
Bond count | 27 |
Number of carbons | 21 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.06 |
Alogp | 2.12 |
Alogp2 | 4.49 |
Apol | 60.1718 |
Bpol | 35.6702 |
EccentricConnectivityIndexDescriptor | 399 |
FmfDescriptor | 0.56 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 2649.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1264 |
Xlogp | 0.001 |
ZagrebIndex | 136 |
TopoPSA | 66.76 |