Name | Piscerythramine |
Wikidata | Q27108015 |
Mol. formula | C26H29NO6 |
CAS registry number | - |
Mol. weight | 451.5125 |
Temporary LOTUS id | LTS0137263 |
Name | Piscerythramine |
Canonical SMILES | COc1c(N)c(O)c(CC=C(C)C)c(-c2coc3cc(O)cc(O)c3c2=O)c1CC=C(C)C |
2D SMILES | COc1c(N)c(O)c(CC=C(C)C)c(-c2coc3cc(O)cc(O)c3c2=O)c1CC=C(C)C |
IUPAC name | 3-[4-amino-3-hydroxy-5-methoxy-2,6-bis(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-4H-chromen-4-one |
InChI | InChI=1S/C26H29NO6/c1-13(2)6-8-16-21(17(9-7-14(3)4)26(32-5)23(27)25(16)31)18-12-33-20-11-15(28)10-19(29)22(20)24(18)30/h6-7,10-12,28-29,31H,8-9,27H2,1-5H3 |
InChIKey | FZVQFYVMVHEMPU-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=C(c2ccccc2)Cc3ccccc13 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Isoflavonoids | Isoflavones |
Total atom number | 62 |
Heavy atom number | 33 |
Bond count | 35 |
Number of carbons | 26 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 5.69 |
Alogp2 | 32.33 |
Apol | 71.009 |
Bpol | 35.833 |
EccentricConnectivityIndexDescriptor | 645 |
FmfDescriptor | 0.4848 |
Fsp3 | 0.2692 |
FragmentComplexityDescriptor | 3040.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2852 |
Xlogp | 6.194 |
ZagrebIndex | 172 |
TopoPSA | 126.15 |