Name | 11-methyl-2,7-dimethylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.0⁴,⁸]tetradec-1(13)-en-9-yl 2-methylpropanoate |
Wikidata | Q105029875 |
Mol. formula | C19H22O6 |
CAS registry number | - |
Mol. weight | 346.3751 |
Temporary LOTUS id | LTS0134019 |
Name | 11-methyl-2,7-dimethylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.0⁴,⁸]tetradec-1(13)-en-9-yl 2-methylpropanoate |
Canonical SMILES | C=C1CC2OC(=O)C(=C)C2C(OC(=O)C(C)C)CC2(C)OC1=CC2=O |
2D SMILES | C=C1CC2OC(=O)C(=C)C2C(OC(=O)C(C)C)CC2(C)OC1=CC2=O |
IUPAC name | 11-methyl-2,7-dimethylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.0⁴,⁸]tetradec-1(13)-en-9-yl 2-methylpropanoate |
InChI | InChI=1S/C19H22O6/c1-9(2)17(21)24-14-8-19(5)15(20)7-12(25-19)10(3)6-13-16(14)11(4)18(22)23-13/h7,9,13-14,16H,3-4,6,8H2,1-2,5H3 |
InChIKey | HKQSOGUZSSFJSM-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C2=CCC1CCC3CCOC3CC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 47 |
Heavy atom number | 25 |
Bond count | 27 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.11 |
Alogp | 1.89 |
Alogp2 | 3.57 |
Apol | 52.9214 |
Bpol | 32.6726 |
EccentricConnectivityIndexDescriptor | 370 |
FmfDescriptor | 0.56 |
Fsp3 | 0.5263 |
FragmentComplexityDescriptor | 1801.06 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1283 |
Xlogp | 1.465 |
ZagrebIndex | 138 |
TopoPSA | 78.9 |