Name | (2s)-2-(6-acetyl-5-hydroxy-1-benzofuran-2-yl)propyl 3-methylbutanoate |
Wikidata | Q105034302 |
Mol. formula | C18H22O5 |
CAS registry number | - |
Mol. weight | 318.365 |
Temporary LOTUS id | LTS0133002 |
Name | (2s)-2-(6-acetyl-5-hydroxy-1-benzofuran-2-yl)propyl 3-methylbutanoate |
Canonical SMILES | CC(=O)c1cc2oc([C@@H](C)COC(=O)CC(C)C)cc2cc1O |
2D SMILES | CC(=O)c1cc2oc(C(C)COC(=O)CC(C)C)cc2cc1O |
IUPAC name | (2S)-2-(6-acetyl-5-hydroxy-1-benzofuran-2-yl)propyl 3-methylbutanoate |
InChI | InChI=1S/C18H22O5/c1-10(2)5-18(21)22-9-11(3)16-7-13-6-15(20)14(12(4)19)8-17(13)23-16/h6-8,10-11,20H,5,9H2,1-4H3/t11-/m0/s1 |
InChIKey | HVJJUTRMYHBMSA-NSHDSACASA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1ccc2ccccc12 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 45 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.03 |
Alogp | 3.54 |
Alogp2 | 12.56 |
Apol | 50.3594 |
Bpol | 29.7986 |
EccentricConnectivityIndexDescriptor | 475 |
FmfDescriptor | 0.3913 |
Fsp3 | 0.4444 |
FragmentComplexityDescriptor | 1610.05 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1336 |
Xlogp | 3.685 |
ZagrebIndex | 116 |
TopoPSA | 76.74 |