Name | 5-hydroxy-2',4'-dioxaspiro[naphthalene-1,3'-tricyclo[7.3.1.0⁵,¹³]tridecane]-1'(13'),5',7',9',11'-pentaen-4-one |
Wikidata | Q77511412 |
Mol. formula | C20H12O4 |
CAS registry number | - |
Mol. weight | 316.3076 |
Temporary LOTUS id | LTS0131439 |
Name | 5-hydroxy-2',4'-dioxaspiro[naphthalene-1,3'-tricyclo[7.3.1.0⁵,¹³]tridecane]-1'(13'),5',7',9',11'-pentaen-4-one |
Canonical SMILES | O=C1C=CC2(Oc3cccc4cccc(c34)O2)c2cccc(O)c21 |
2D SMILES | O=C1C=CC2(Oc3cccc4cccc(c34)O2)c2cccc(O)c21 |
IUPAC name | 5-hydroxy-4H-2',4'-dioxaspiro[naphthalene-1,3'-tricyclo[7.3.1.0⁵,¹³]tridecane]-1'(13'),5',7',9',11'-pentaen-4-one |
InChI | InChI=1S/C20H12O4/c21-14-7-3-6-13-19(14)15(22)10-11-20(13)23-16-8-1-4-12-5-2-9-17(24-20)18(12)16/h1-11,21H |
InChIKey | LVOXAJYEGVDSQA-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cccc3cccc(OC14C=CCc5ccccc54)c23 |
Pathway | Superclass | Class |
Polyketides | Naphthalenes | Spirodioxynaphthalenes |
Total atom number | 36 |
Heavy atom number | 24 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 10 |
NP-likeness score | 1.02 |
Alogp | 4.13 |
Alogp2 | 17.02 |
Apol | 46.4095 |
Bpol | 17.9085 |
EccentricConnectivityIndexDescriptor | 396 |
FmfDescriptor | 0.9167 |
Fsp3 | 0.05 |
FragmentComplexityDescriptor | 1048.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1140 |
Xlogp | 4.209 |
ZagrebIndex | 142 |
TopoPSA | 55.76 |