Name | (3ar,4as,8r,8ar,9ar)-8-hydroxy-5,8a-dimethyl-3-methylidene-3ah,4h,4ah,7h,8h,9h,9ah-naphtho[2,3-b]furan-2-one |
Wikidata | Q105252553 |
Mol. formula | C15H20O3 |
CAS registry number | - |
Mol. weight | 248.3181 |
Temporary LOTUS id | LTS0129533 |
Name | (3ar,4as,8r,8ar,9ar)-8-hydroxy-5,8a-dimethyl-3-methylidene-3ah,4h,4ah,7h,8h,9h,9ah-naphtho[2,3-b]furan-2-one |
Canonical SMILES | C=C1C(=O)O[C@@H]2C[C@]3(C)[C@@H](C[C@H]12)C(C)=CC[C@H]3O |
2D SMILES | C=C1C(=O)OC2CC3(C)C(O)CC=C(C)C3CC12 |
IUPAC name | (3aR,4aS,8R,8aR,9aR)-8-hydroxy-5,8a-dimethyl-3-methylidene-2H,3H,3aH,4H,4aH,7H,8H,8aH,9H,9aH-naphtho[2,3-b]furan-2-one |
InChI | InChI=1S/C15H20O3/c1-8-4-5-13(16)15(3)7-12-10(6-11(8)15)9(2)14(17)18-12/h4,10-13,16H,2,5-7H2,1,3H3/t10-,11+,12-,13-,15-/m1/s1 |
InChIKey | SGRJYGRCAPBLSW-WPLOAARJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC3C=CCCC3CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 38 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 0.98 |
Alogp | 2.21 |
Alogp2 | 4.88 |
Apol | 42.1419 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 227 |
FmfDescriptor | 0.7222 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1294.03 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 520 |
Xlogp | 1.551 |
ZagrebIndex | 104 |
TopoPSA | 46.53 |