Name | 8a-methyl-3,5-dimethylidene-3ah,4h,4ah,9h,9ah-naphtho[2,3-b]furan-2,6-dione |
Wikidata | Q105158943 |
Mol. formula | C15H16O3 |
CAS registry number | - |
Mol. weight | 244.2863 |
Temporary LOTUS id | LTS0129449 |
Name | 8a-methyl-3,5-dimethylidene-3ah,4h,4ah,9h,9ah-naphtho[2,3-b]furan-2,6-dione |
Canonical SMILES | C=C1C(=O)OC2CC3(C)C=CC(=O)C(=C)C3CC12 |
2D SMILES | C=C1C(=O)OC2CC3(C)C=CC(=O)C(=C)C3CC12 |
IUPAC name | 8a-methyl-3,5-dimethylidene-2H,3H,3aH,4H,4aH,5H,6H,8aH,9H,9aH-naphtho[2,3-b]furan-2,6-dione |
InChI | InChI=1S/C15H16O3/c1-8-10-6-11-9(2)12(16)4-5-15(11,3)7-13(10)18-14(8)17/h4-5,10-11,13H,1-2,6-7H2,3H3 |
InChIKey | LXMUZMFQJGRVFW-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC3CCC=CC3CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 34 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 2.2 |
Alogp2 | 4.84 |
Apol | 39.4747 |
Bpol | 21.3233 |
EccentricConnectivityIndexDescriptor | 240 |
FmfDescriptor | 0.7222 |
Fsp3 | 0.4667 |
FragmentComplexityDescriptor | 990.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 528 |
Xlogp | 1.359 |
ZagrebIndex | 104 |
TopoPSA | 43.37 |