Name | Precocene i |
Wikidata | Q27108062 |
Mol. formula | C12H14O2 |
CAS registry number | - |
Mol. weight | 190.2388 |
Temporary LOTUS id | LTS0128290 |
Name | Precocene i |
Canonical SMILES | COc1ccc2c(c1)OC(C)(C)C=C2 |
2D SMILES | COc1ccc2c(c1)OC(C)(C)C=C2 |
IUPAC name | 7-methoxy-2,2-dimethyl-2H-chromene |
InChI | InChI=1S/C12H14O2/c1-12(2)7-6-9-4-5-10(13-3)8-11(9)14-12/h4-8H,1-3H3 |
InChIKey | CPTJXGLQLVPIGP-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2C=CC1 |
Pathway | Superclass | Class |
Terpenoids | Meroterpenoids | Merohemiterpenoids |
Total atom number | 28 |
Heavy atom number | 14 |
Bond count | 15 |
Number of carbons | 12 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 2.6 |
Alogp2 | 6.77 |
Apol | 32.0591 |
Bpol | 19.1369 |
EccentricConnectivityIndexDescriptor | 165 |
FmfDescriptor | 0.7143 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 659.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 288 |
Xlogp | 2.778 |
ZagrebIndex | 74 |
TopoPSA | 18.46 |