Name | (1r,3s,4r,5s,7r)-6-methyl-2-oxa-6-azatricyclo[3.3.1.0³,⁷]nonan-4-yl (2r)-2,3-dihydroxy-2-phenylpropanoate |
Wikidata | Q105338978 |
Mol. formula | C17H21NO5 |
CAS registry number | - |
Mol. weight | 319.353 |
Temporary LOTUS id | LTS0127834 |
Name | (1r,3s,4r,5s,7r)-6-methyl-2-oxa-6-azatricyclo[3.3.1.0³,⁷]nonan-4-yl (2r)-2,3-dihydroxy-2-phenylpropanoate |
Canonical SMILES | CN1[C@H]2C[C@H]3C[C@@H]1[C@H](O3)[C@@H]2OC(=O)[C@](O)(CO)c1ccccc1 |
2D SMILES | CN1C2CC3CC1C(O3)C2OC(=O)C(O)(CO)c1ccccc1 |
IUPAC name | (1R,3S,4R,5S,7R)-6-methyl-2-oxa-6-azatricyclo[3.3.1.0³,⁷]nonan-4-yl (2R)-2,3-dihydroxy-2-phenylpropanoate |
InChI | InChI=1S/C17H21NO5/c1-18-12-7-11-8-13(18)15(14(12)22-11)23-16(20)17(21,9-19)10-5-3-2-4-6-10/h2-6,11-15,19,21H,7-9H2,1H3/t11-,12-,13+,14+,15-,17+/m1/s1 |
InChIKey | XPSOWKZBQQGOCO-IXYRMGKJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CCc1ccccc1)C2C3OC4CC2NC3C4 |
Pathway | Superclass | Class |
Alkaloids | Ornithine alkaloids | Tropane alkaloids |
Total atom number | 44 |
Heavy atom number | 23 |
Bond count | 26 |
Number of carbons | 17 |
Minimal number of rings | 4 |
Maximal number of rings | 8 |
NP-likeness score | 1.43 |
Alogp | 0.22 |
Alogp2 | 0.05 |
Apol | 49.0327 |
Bpol | 29.7273 |
EccentricConnectivityIndexDescriptor | 414 |
FmfDescriptor | 0.7826 |
Fsp3 | 0.5882 |
FragmentComplexityDescriptor | 1703.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1123 |
Xlogp | 0.095 |
ZagrebIndex | 132 |
TopoPSA | 79.23 |