Name | 1-[(2s)-2-(hydroxymethyl)-8-methoxy-2-methylchromen-6-yl]ethanone |
Wikidata | Q104935611 |
Mol. formula | C14H16O4 |
CAS registry number | - |
Mol. weight | 248.275 |
Temporary LOTUS id | LTS0127584 |
Name | 1-[(2s)-2-(hydroxymethyl)-8-methoxy-2-methylchromen-6-yl]ethanone |
Canonical SMILES | COc1cc(C(C)=O)cc2c1O[C@](C)(CO)C=C2 |
2D SMILES | COc1cc(C(C)=O)cc2c1OC(C)(CO)C=C2 |
IUPAC name | 1-[(2S)-2-(hydroxymethyl)-8-methoxy-2-methyl-2H-chromen-6-yl]ethan-1-one |
InChI | InChI=1S/C14H16O4/c1-9(16)11-6-10-4-5-14(2,8-15)18-13(10)12(7-11)17-3/h4-7,15H,8H2,1-3H3/t14-/m0/s1 |
InChIKey | BGLSNKBXOCURCJ-AWEZNQCLSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2C=CC1 |
Pathway | Superclass | Class |
Polyketides|Polyketides | |Meroterpenoids | |Miscellaneous meroterpenoids |
Total atom number | 34 |
Heavy atom number | 18 |
Bond count | 19 |
Number of carbons | 14 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.03 |
Alogp | 1.45 |
Alogp2 | 2.11 |
Apol | 38.5167 |
Bpol | 22.2813 |
EccentricConnectivityIndexDescriptor | 246 |
FmfDescriptor | 0.5556 |
Fsp3 | 0.3571 |
FragmentComplexityDescriptor | 919.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 570 |
Xlogp | 1.255 |
ZagrebIndex | 94 |
TopoPSA | 55.76 |