Name | 3,6,10-trimethyl-4h,7h,8h,11h-cyclodeca[b]furan-8-yl acetate |
Wikidata | Q105286712 |
Mol. formula | C17H22O3 |
CAS registry number | - |
Mol. weight | 274.3554 |
Temporary LOTUS id | LTS0126769 |
Name | 3,6,10-trimethyl-4h,7h,8h,11h-cyclodeca[b]furan-8-yl acetate |
Canonical SMILES | CC(=O)OC1C=C(C)Cc2occ(C)c2CC=C(C)C1 |
2D SMILES | CC(=O)OC1C=C(C)Cc2occ(C)c2CC=C(C)C1 |
IUPAC name | 3,6,10-trimethyl-4H,7H,8H,11H-cyclodeca[b]furan-8-yl acetate |
InChI | InChI=1S/C17H22O3/c1-11-5-6-16-13(3)10-19-17(16)9-12(2)8-15(7-11)20-14(4)18/h5,8,10,15H,6-7,9H2,1-4H3 |
InChIKey | VIAGREYUICSQGX-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1ccc2c1CC=CCCC=CC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 42 |
Heavy atom number | 20 |
Bond count | 21 |
Number of carbons | 17 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.01 |
Alogp | 3.91 |
Alogp2 | 15.28 |
Apol | 46.9954 |
Bpol | 28.8406 |
EccentricConnectivityIndexDescriptor | 304 |
FmfDescriptor | 0.65 |
Fsp3 | 0.4706 |
FragmentComplexityDescriptor | 1469.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 782 |
Xlogp | 2.838 |
ZagrebIndex | 100 |
TopoPSA | 39.44 |