Name | 5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.0¹,¹⁰.0⁴,⁹.0¹²,¹⁴]hexadecan-2-ol |
Wikidata | Q104921154 |
Mol. formula | C20H32O2 |
CAS registry number | - |
Mol. weight | 304.4676 |
Temporary LOTUS id | LTS0125387 |
Name | 5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.0¹,¹⁰.0⁴,⁹.0¹²,¹⁴]hexadecan-2-ol |
Canonical SMILES | CC1(CO)CCCC2(C)C1CC(O)C13CC4C(CC21)C4(C)C3 |
2D SMILES | CC1(CO)CCCC2(C)C1CC(O)C13CC4C(CC21)C4(C)C3 |
IUPAC name | 5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.0¹,¹⁰.0⁴,⁹.0¹²,¹⁴]hexadecan-2-ol |
InChI | InChI=1S/C20H32O2/c1-17(11-21)5-4-6-18(2)14(17)8-16(22)20-9-13-12(7-15(18)20)19(13,3)10-20/h12-16,21-22H,4-11H2,1-3H3 |
InChIKey | AYJDZPIYFBFTNU-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2C(C1)CCC34CC5C(CC23)C5C4 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Trachylobane diterpenoids |
Total atom number | 54 |
Heavy atom number | 22 |
Bond count | 26 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 18 |
NP-likeness score | 1 |
Alogp | 2.81 |
Alogp2 | 7.89 |
Apol | 58.1414 |
Bpol | 34.9826 |
EccentricConnectivityIndexDescriptor | 343 |
FmfDescriptor | 0.7273 |
Fsp3 | 1 |
FragmentComplexityDescriptor | 2902.02 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 841 |
Xlogp | 5.197 |
ZagrebIndex | 146 |
TopoPSA | 40.46 |