Name | Emodin 6,8-dimethyl ether |
Wikidata | Q27252287 |
Mol. formula | C17H14O5 |
CAS registry number | - |
Mol. weight | 298.2907 |
Temporary LOTUS id | LTS0123748 |
Name | Emodin 6,8-dimethyl ether |
Canonical SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
2D SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
IUPAC name | 1-hydroxy-6,8-dimethoxy-3-methyl-9,10-dihydroanthracene-9,10-dione |
InChI | InChI=1S/C17H14O5/c1-8-4-10-14(12(18)5-8)17(20)15-11(16(10)19)6-9(21-2)7-13(15)22-3/h4-7,18H,1-3H3 |
InChIKey | QJKZQZYKOMVBQO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)Cc3ccccc3C2 |
Pathway | Superclass | Class |
Polyketides | Polycyclic aromatic polyketides | Anthraquinones and anthrones |
Total atom number | 36 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.04 |
Alogp | 2.99 |
Alogp2 | 8.97 |
Apol | 43.2651 |
Bpol | 21.0529 |
EccentricConnectivityIndexDescriptor | 336 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.1765 |
FragmentComplexityDescriptor | 982.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 914 |
Xlogp | 2.969 |
ZagrebIndex | 120 |
TopoPSA | 72.83 |