Name | 1-[(12r,13r)-13-hydroxy-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,14,16,18-hexaen-11-yl]but-2-en-1-one |
Wikidata | Q105151460 |
Mol. formula | C21H19NO4 |
CAS registry number | - |
Mol. weight | 349.3807 |
Temporary LOTUS id | LTS0119436 |
Name | 1-[(12r,13r)-13-hydroxy-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,14,16,18-hexaen-11-yl]but-2-en-1-one |
Canonical SMILES | CC=CC(=O)N1CCc2cc3c(c4c2[C@@H]1[C@H](O)c1ccccc1-4)OCO3 |
2D SMILES | CC=CC(=O)N1CCc2cc3c(c4c2C1C(O)c1ccccc1-4)OCO3 |
IUPAC name | 1-[(12R,13R)-13-hydroxy-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,14,16,18-hexaen-11-yl]but-2-en-1-one |
InChI | InChI=1S/C21H19NO4/c1-2-5-16(23)22-9-8-12-10-15-21(26-11-25-15)18-13-6-3-4-7-14(13)20(24)19(22)17(12)18/h2-7,10,19-20,24H,8-9,11H2,1H3/t19-,20-/m1/s1 |
InChIKey | LGMGIUVWEZJWJS-WOJBJXKFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cc3c4c(c2OC1)-c5ccccc5CC4NCC3 |
Pathway | Superclass | Class |
Alkaloids | Tyrosine alkaloids | Aporphine alkaloids |
Total atom number | 45 |
Heavy atom number | 26 |
Bond count | 30 |
Number of carbons | 21 |
Minimal number of rings | 5 |
Maximal number of rings | 19 |
NP-likeness score | 0.94 |
Alogp | 2.9 |
Alogp2 | 8.39 |
Apol | 53.9371 |
Bpol | 27.5409 |
EccentricConnectivityIndexDescriptor | 461 |
FmfDescriptor | 0.7692 |
Fsp3 | 0.2857 |
FragmentComplexityDescriptor | 1751.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1389 |
Xlogp | 2.838 |
ZagrebIndex | 150 |
TopoPSA | 59 |