Name | Methyl (5r,6r,7r)-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-2h,5h,6h,7h,8h-naphtho[2,3-d][1,3]dioxole-6-carboxylate |
Wikidata | Q105174080 |
Mol. formula | C23H26O8 |
CAS registry number | - |
Mol. weight | 430.4486 |
Temporary LOTUS id | LTS0119333 |
Name | Methyl (5r,6r,7r)-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-2h,5h,6h,7h,8h-naphtho[2,3-d][1,3]dioxole-6-carboxylate |
Canonical SMILES | COC(=O)[C@H]1[C@H](CO)Cc2cc3c(cc2[C@H]1c1cc(OC)c(OC)c(OC)c1)OCO3 |
2D SMILES | COC(=O)C1C(CO)Cc2cc3c(cc2C1c1cc(OC)c(OC)c(OC)c1)OCO3 |
IUPAC name | methyl (5R,6R,7R)-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-2H,5H,6H,7H,8H-naphtho[2,3-d][1,3]dioxole-6-carboxylate |
InChI | InChI=1S/C23H26O8/c1-26-18-7-13(8-19(27-2)22(18)28-3)20-15-9-17-16(30-11-31-17)6-12(15)5-14(10-24)21(20)23(25)29-4/h6-9,14,20-21,24H,5,10-11H2,1-4H3/t14-,20+,21-/m0/s1 |
InChIKey | MXGHOMGUPJFHLU-DLPLYFIVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cc3c(cc2OC1)C(c4ccccc4)CCC3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Arylnaphthalene and aryltetralin lignans |
Total atom number | 57 |
Heavy atom number | 31 |
Bond count | 34 |
Number of carbons | 23 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 2.85 |
Alogp2 | 8.12 |
Apol | 64.2326 |
Bpol | 40.8774 |
EccentricConnectivityIndexDescriptor | 578 |
FmfDescriptor | 0.6129 |
Fsp3 | 0.4348 |
FragmentComplexityDescriptor | 2670.08 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2339 |
Xlogp | 1.902 |
ZagrebIndex | 166 |
TopoPSA | 92.68 |