Name | (6s)-6-hydroxy-6-(hydroxymethyl)-1-methyl-7h,8h,9h-phenanthro[1,2-b]furan-10,11-dione |
Wikidata | Q104394045 |
Mol. formula | C18H16O5 |
CAS registry number | - |
Mol. weight | 312.3173 |
Temporary LOTUS id | LTS0118820 |
Name | (6s)-6-hydroxy-6-(hydroxymethyl)-1-methyl-7h,8h,9h-phenanthro[1,2-b]furan-10,11-dione |
Canonical SMILES | Cc1coc2c1C(=O)C(=O)c1c-2ccc2c1CCC[C@@]2(O)CO |
2D SMILES | Cc1coc2c1C(=O)C(=O)c1c-2ccc2c1CCCC2(O)CO |
IUPAC name | (6S)-6-hydroxy-6-(hydroxymethyl)-1-methyl-6H,7H,8H,9H,10H,11H-phenanthro[1,2-b]furan-10,11-dione |
InChI | InChI=1S/C18H16O5/c1-9-7-23-17-11-4-5-12-10(3-2-6-18(12,22)8-19)14(11)16(21)15(20)13(9)17/h4-5,7,19,22H,2-3,6,8H2,1H3/t18-/m1/s1 |
InChIKey | TZHMQUSSYNZSTA-GOSISDBHSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1ccc2c1-c3ccc4c(c3CC2)CCCC4 |
Pathway | Superclass | Class |
Polyketides | Naphthalenes | Naphthoquinones |
Total atom number | 39 |
Heavy atom number | 23 |
Bond count | 26 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.32 |
Alogp | 2.42 |
Alogp2 | 5.85 |
Apol | 46.3587 |
Bpol | 21.3233 |
EccentricConnectivityIndexDescriptor | 381 |
FmfDescriptor | 0.7391 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 1258.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1015 |
Xlogp | 1.109 |
ZagrebIndex | 134 |
TopoPSA | 87.74 |