Name | 4,5-dihydroxy-6-(hydroxymethyl)-2-(1,3,6,7-tetrahydroxy-9-oxoxanthen-2-yl)oxan-3-yl benzoate |
Wikidata | Q104085845 |
Mol. formula | C26H22O12 |
CAS registry number | - |
Mol. weight | 526.4467 |
Temporary LOTUS id | LTS0118565 |
Name | 4,5-dihydroxy-6-(hydroxymethyl)-2-(1,3,6,7-tetrahydroxy-9-oxoxanthen-2-yl)oxan-3-yl benzoate |
Canonical SMILES | O=C(OC1C(c2c(O)cc3oc4cc(O)c(O)cc4c(=O)c3c2O)OC(CO)C(O)C1O)c1ccccc1 |
2D SMILES | O=C(OC1C(c2c(O)cc3oc4cc(O)c(O)cc4c(=O)c3c2O)OC(CO)C(O)C1O)c1ccccc1 |
IUPAC name | 4,5-dihydroxy-6-(hydroxymethyl)-2-(1,3,6,7-tetrahydroxy-9-oxo-9H-xanthen-2-yl)oxan-3-yl benzoate |
InChI | InChI=1S/C26H22O12/c27-9-17-21(32)23(34)25(38-26(35)10-4-2-1-3-5-10)24(37-17)18-14(30)8-16-19(22(18)33)20(31)11-6-12(28)13(29)7-15(11)36-16/h1-8,17,21,23-25,27-30,32-34H,9H2 |
InChIKey | AVPLATUJXHPZBU-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2Cc3ccccc13.c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Xanthones | Plant xanthones |
Total atom number | 60 |
Heavy atom number | 38 |
Bond count | 42 |
Number of carbons | 26 |
Minimal number of rings | 5 |
Maximal number of rings | 8 |
NP-likeness score | 1 |
Alogp | 1.8 |
Alogp2 | 3.25 |
Apol | 70.0534 |
Bpol | 31.7146 |
EccentricConnectivityIndexDescriptor | 996 |
FmfDescriptor | 0.7368 |
Fsp3 | 0.2308 |
FragmentComplexityDescriptor | 2690.12 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 2 |
WienerPathNumber | 4332 |
Xlogp | 2.977 |
ZagrebIndex | 210 |
TopoPSA | 207.35 |