Name | (10e,12e,14e)-9,16-dioxooctadeca-10,12,14-trienoic acid |
Wikidata | Q105213337 |
Mol. formula | C18H26O4 |
CAS registry number | - |
Mol. weight | 306.3973 |
Temporary LOTUS id | LTS0118465 |
Name | (10e,12e,14e)-9,16-dioxooctadeca-10,12,14-trienoic acid |
Canonical SMILES | CCC(=O)/C=C/C=C/C=C/C(=O)CCCCCCCC(=O)O |
2D SMILES | CCC(=O)C=CC=CC=CC(=O)CCCCCCCC(=O)O |
IUPAC name | (10E,12E,14E)-9,16-dioxooctadeca-10,12,14-trienoic acid |
InChI | InChI=1S/C18H26O4/c1-2-16(19)12-8-6-7-10-14-17(20)13-9-4-3-5-11-15-18(21)22/h6-8,10,12,14H,2-5,9,11,13,15H2,1H3,(H,21,22)/b7-6+,12-8+,14-10+ |
InChIKey | PQPRTPXWQQQKJC-KDXRDGMUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids|Fatty acids | Octadecanoids|Fatty Acids and Conjugates | Other Octadecanoids|Oxo fatty acids |
Total atom number | 48 |
Heavy atom number | 22 |
Bond count | 21 |
Number of carbons | 18 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.32 |
Alogp | 3.66 |
Alogp2 | 13.42 |
Apol | 52.2246 |
Bpol | 31.2974 |
EccentricConnectivityIndexDescriptor | 573 |
FmfDescriptor | 0 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 1747.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1616 |
Xlogp | 3.12 |
ZagrebIndex | 88 |
TopoPSA | 71.44 |