Name | 4-hydroxy-4-(2-{[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}ethyl)cyclohexa-2,5-dien-1-one |
Wikidata | Q104375849 |
Mol. formula | C14H20O8 |
CAS registry number | - |
Mol. weight | 316.3044 |
Temporary LOTUS id | LTS0118163 |
Name | 4-hydroxy-4-(2-{[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}ethyl)cyclohexa-2,5-dien-1-one |
Canonical SMILES | O=C1C=CC(O)(CCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C1 |
2D SMILES | O=C1C=CC(O)(CCOC2OC(CO)C(O)C(O)C2O)C=C1 |
IUPAC name | 4-hydroxy-4-(2-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}ethyl)cyclohexa-2,5-dien-1-one |
InChI | InChI=1S/C14H20O8/c15-7-9-10(17)11(18)12(19)13(22-9)21-6-5-14(20)3-1-8(16)2-4-14/h1-4,9-13,15,17-20H,5-7H2/t9-,10-,11+,12-,13-/m1/s1 |
InChIKey | VTVARPTUBCBNJX-UJPOAAIJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCC=CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylethanoids (C6-C2) | Phenylethanoids |
Total atom number | 42 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 14 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.64 |
Alogp | -2.21 |
Alogp2 | 4.87 |
Apol | 44.3919 |
Bpol | 26.6541 |
EccentricConnectivityIndexDescriptor | 431 |
FmfDescriptor | 0.6818 |
Fsp3 | 0.6429 |
FragmentComplexityDescriptor | 1387.08 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1149 |
Xlogp | -1.726 |
ZagrebIndex | 112 |
TopoPSA | 136.68 |