Name | 10,22-dihydroxy-7,7,18,18-tetramethyl-8,13,17-trioxapentacyclo[12.8.0.0³,¹².0⁴,⁹.0¹⁶,²¹]docosa-1(22),3,9,11,14,16(21),19-heptaen-2-one |
Wikidata | Q105012263 |
Mol. formula | C23H22O6 |
CAS registry number | - |
Mol. weight | 394.4181 |
Temporary LOTUS id | LTS0116124 |
Name | 10,22-dihydroxy-7,7,18,18-tetramethyl-8,13,17-trioxapentacyclo[12.8.0.0³,¹².0⁴,⁹.0¹⁶,²¹]docosa-1(22),3,9,11,14,16(21),19-heptaen-2-one |
Canonical SMILES | CC1(C)C=Cc2c(cc3oc4cc(O)c5c(c4c(=O)c3c2O)CCC(C)(C)O5)O1 |
2D SMILES | CC1(C)C=Cc2c(cc3oc4cc(O)c5c(c4c(=O)c3c2O)CCC(C)(C)O5)O1 |
IUPAC name | 10,22-dihydroxy-7,7,18,18-tetramethyl-8,13,17-trioxapentacyclo[12.8.0.0³,¹².0⁴,⁹.0¹⁶,²¹]docosa-1(22),3,9,11,14,16(21),19-heptaen-2-one |
InChI | InChI=1S/C23H22O6/c1-22(2)7-5-11-14(28-22)10-16-18(19(11)25)20(26)17-12-6-8-23(3,4)29-21(12)13(24)9-15(17)27-16/h5,7,9-10,24-25H,6,8H2,1-4H3 |
InChIKey | GNAKQPCICCWJIB-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc3OCCCc3c2Cc4cc5C=CCOc5cc14 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Xanthones | Plant xanthones |
Total atom number | 51 |
Heavy atom number | 29 |
Bond count | 33 |
Number of carbons | 23 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1 |
Alogp | 4.57 |
Alogp2 | 20.87 |
Apol | 59.9614 |
Bpol | 30.7566 |
EccentricConnectivityIndexDescriptor | 627 |
FmfDescriptor | 0.7586 |
Fsp3 | 0.3478 |
FragmentComplexityDescriptor | 2213.06 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2028 |
Xlogp | 4.969 |
ZagrebIndex | 174 |
TopoPSA | 89.13 |