Name | 2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1h-naphthalen-2-yl)prop-2-en-1-ol |
Wikidata | Q105120250 |
Mol. formula | C15H24O |
CAS registry number | - |
Mol. weight | 220.351 |
Temporary LOTUS id | LTS0116038 |
Name | 2-(4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1h-naphthalen-2-yl)prop-2-en-1-ol |
Canonical SMILES | C=C(CO)C1CCC2(C)CCCC(C)=C2C1 |
2D SMILES | C=C(CO)C1CCC2(C)CCCC(C)=C2C1 |
IUPAC name | 2-(4a,8-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-2-yl)prop-2-en-1-ol |
InChI | InChI=1S/C15H24O/c1-11-5-4-7-15(3)8-6-13(9-14(11)15)12(2)10-16/h13,16H,2,4-10H2,1,3H3 |
InChIKey | ITRHZWKEZJYJQO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CCCCC2CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 16 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 3.86 |
Alogp2 | 14.88 |
Apol | 43.205 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 205 |
FmfDescriptor | 0.625 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1441.01 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 409 |
Xlogp | 3.519 |
ZagrebIndex | 84 |
TopoPSA | 20.23 |