Name | Methyl 2-[(1s,2s)-3-methoxy-5-oxo-2-[(1z)-prop-1-en-1-yl]cyclopent-3-en-1-yl]acetate |
Wikidata | Q105303636 |
Mol. formula | C12H16O4 |
CAS registry number | - |
Mol. weight | 224.2535 |
Temporary LOTUS id | LTS0115716 |
Name | Methyl 2-[(1s,2s)-3-methoxy-5-oxo-2-[(1z)-prop-1-en-1-yl]cyclopent-3-en-1-yl]acetate |
Canonical SMILES | C/C=C\[C@@H]1C(OC)=CC(=O)[C@H]1CC(=O)OC |
2D SMILES | CC=CC1C(OC)=CC(=O)C1CC(=O)OC |
IUPAC name | methyl 2-[(1S,2S)-3-methoxy-5-oxo-2-[(1Z)-prop-1-en-1-yl]cyclopent-3-en-1-yl]acetate |
InChI | InChI=1S/C12H16O4/c1-4-5-8-9(6-12(14)16-3)10(13)7-11(8)15-2/h4-5,7-9H,6H2,1-3H3/b5-4-/t8-,9-/m0/s1 |
InChIKey | WEXBONOFEQOHQL-NSVKDGAOSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCC1 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 32 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 12 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.04 |
Alogp | 0.71 |
Alogp2 | 0.51 |
Apol | 34.9967 |
Bpol | 23.2393 |
EccentricConnectivityIndexDescriptor | 191 |
FmfDescriptor | 0.3125 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 784.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 438 |
Xlogp | 1.005 |
ZagrebIndex | 74 |
TopoPSA | 52.6 |