Name | 3-(6-hydroxy-2,3,4-trimethoxyphenyl)-1-phenylpropan-1-one |
Wikidata | Q105344020 |
Mol. formula | C18H20O5 |
CAS registry number | - |
Mol. weight | 316.3491 |
Temporary LOTUS id | LTS0115507 |
Name | 3-(6-hydroxy-2,3,4-trimethoxyphenyl)-1-phenylpropan-1-one |
Canonical SMILES | COc1cc(O)c(CCC(=O)c2ccccc2)c(OC)c1OC |
2D SMILES | COc1cc(O)c(CCC(=O)c2ccccc2)c(OC)c1OC |
IUPAC name | 3-(6-hydroxy-2,3,4-trimethoxyphenyl)-1-phenylpropan-1-one |
InChI | InChI=1S/C18H20O5/c1-21-16-11-15(20)13(17(22-2)18(16)23-3)9-10-14(19)12-7-5-4-6-8-12/h4-8,11,20H,9-10H2,1-3H3 |
InChIKey | XXHGGLKQZUXJDI-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)CCCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Chalcones |
Total atom number | 43 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.02 |
Alogp | 3.41 |
Alogp2 | 11.62 |
Apol | 49.0259 |
Bpol | 28.5701 |
EccentricConnectivityIndexDescriptor | 440 |
FmfDescriptor | 0.6522 |
Fsp3 | 0.2778 |
FragmentComplexityDescriptor | 1430.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1234 |
Xlogp | 2.668 |
ZagrebIndex | 112 |
TopoPSA | 64.99 |