Temporary LOTUS id | LTS0113640 |
Name | Mesitylene |
Canonical SMILES | Cc1cc(C)cc(C)c1 |
2D SMILES | Cc1cc(C)cc(C)c1 |
IUPAC name | 1,3,5-trimethylbenzene |
InChI | InChI=1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3 |
InChIKey | AUHZEENZYGFFBQ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Polyketides | - | - |
Total atom number | 21 |
Heavy atom number | 9 |
Bond count | 9 |
Number of carbons | 9 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 3.29 |
Alogp2 | 10.81 |
Apol | 23.8415 |
Bpol | 13.1185 |
EccentricConnectivityIndexDescriptor | 63 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 369 |
PetitjeanNumber | 0.25 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 84 |
Xlogp | 3.333 |
ZagrebIndex | 42 |
TopoPSA | 0 |