Name | 4-hydroxy-2,4a,6a,8a,12b,14a-hexamethyl-9-methylidene-2,4,5,6,6b,7,8,12,12a,13,14,14b-dodecahydro-1h-picen-3-one |
Wikidata | Q105297895 |
Mol. formula | C29H44O2 |
CAS registry number | - |
Mol. weight | 424.6595 |
Temporary LOTUS id | LTS0113138 |
Name | 4-hydroxy-2,4a,6a,8a,12b,14a-hexamethyl-9-methylidene-2,4,5,6,6b,7,8,12,12a,13,14,14b-dodecahydro-1h-picen-3-one |
Canonical SMILES | C=C1C=CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)C(=O)C(O)C3(C)CCC12C |
2D SMILES | C=C1C=CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)C(=O)C(O)C3(C)CCC12C |
IUPAC name | 4-hydroxy-2,4a,6a,8a,12b,14a-hexamethyl-9-methylidene-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,12,12a,12b,13,14,14a,14b-icosahydropicen-3-one |
InChI | InChI=1S/C29H44O2/c1-18-17-22-27(5,24(31)23(18)30)14-16-28(6)21-11-12-25(3)19(2)9-8-10-20(25)26(21,4)13-15-29(22,28)7/h8-9,18,20-22,24,31H,2,10-17H2,1,3-7H3 |
InChIKey | VVUDCWPSEIDKOG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCC2C(C1)CCC3C2CCC4C5CCCCC5CCC43 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Friedelane triterpenoids |
Total atom number | 75 |
Heavy atom number | 31 |
Bond count | 35 |
Number of carbons | 29 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1.02 |
Alogp | 5.91 |
Alogp2 | 34.94 |
Apol | 81.9829 |
Bpol | 49.0591 |
EccentricConnectivityIndexDescriptor | 623 |
FmfDescriptor | 0.7097 |
Fsp3 | 0.8276 |
FragmentComplexityDescriptor | 5311.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2216 |
Xlogp | 9.81 |
ZagrebIndex | 192 |
TopoPSA | 37.3 |