Temporary LOTUS id | LTS0110435 |
Name | Yangonin |
Canonical SMILES | COc1ccc(/C=C/c2cc(OC)cc(=O)o2)cc1 |
2D SMILES | COc1ccc(C=Cc2cc(OC)cc(=O)o2)cc1 |
IUPAC name | 4-methoxy-6-[(1E)-2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one |
InChI | InChI=1S/C15H14O4/c1-17-12-6-3-11(4-7-12)5-8-13-9-14(18-2)10-15(16)19-13/h3-10H,1-2H3/b8-5+ |
InChIKey | XLHIYUYCSMZCCC-VMPITWQZSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C(=CC=CC1)C=Cc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Styrylpyrones | Kavalactones and derivatives |
Total atom number | 33 |
Heavy atom number | 19 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 3.21 |
Alogp2 | 10.33 |
Apol | 38.9431 |
Bpol | 22.0109 |
EccentricConnectivityIndexDescriptor | 366 |
FmfDescriptor | 0.7368 |
Fsp3 | 0.1333 |
FragmentComplexityDescriptor | 814.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 808 |
Xlogp | 3.13 |
ZagrebIndex | 92 |
TopoPSA | 48.67 |