Name | 2-(hydroxymethyl)-6-{[3-(4-hydroxyphenyl)prop-2-en-1-yl]oxy}oxane-3,4,5-triol |
Wikidata | Q104966129 |
Mol. formula | C15H20O7 |
CAS registry number | - |
Mol. weight | 312.3157 |
Temporary LOTUS id | LTS0109848 |
Name | 2-(hydroxymethyl)-6-{[3-(4-hydroxyphenyl)prop-2-en-1-yl]oxy}oxane-3,4,5-triol |
Canonical SMILES | OCC1OC(OCC=Cc2ccc(O)cc2)C(O)C(O)C1O |
2D SMILES | OCC1OC(OCC=Cc2ccc(O)cc2)C(O)C(O)C1O |
IUPAC name | 2-(hydroxymethyl)-6-{[3-(4-hydroxyphenyl)prop-2-en-1-yl]oxy}oxane-3,4,5-triol |
InChI | InChI=1S/C15H20O7/c16-8-11-12(18)13(19)14(20)15(22-11)21-7-1-2-9-3-5-10(17)6-4-9/h1-6,11-20H,7-8H2 |
InChIKey | CNNXMGXBAZQZDE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 42 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | -0.32 |
Alogp2 | 0.1 |
Apol | 45.3499 |
Bpol | 25.6961 |
EccentricConnectivityIndexDescriptor | 472 |
FmfDescriptor | 0.7273 |
Fsp3 | 0.4667 |
FragmentComplexityDescriptor | 1387.07 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1233 |
Xlogp | 0.299 |
ZagrebIndex | 108 |
TopoPSA | 119.61 |