Name | 4-methoxy-5-(3-phenylprop-2-en-1-ylidene)-7ah-1-benzofuran |
Wikidata | Q105029723 |
Mol. formula | C18H16O2 |
CAS registry number | - |
Mol. weight | 264.3191 |
Temporary LOTUS id | LTS0108682 |
Name | 4-methoxy-5-(3-phenylprop-2-en-1-ylidene)-7ah-1-benzofuran |
Canonical SMILES | COC1=C2C=COC2C=CC1=CC=Cc1ccccc1 |
2D SMILES | COC1=C2C=COC2C=CC1=CC=Cc1ccccc1 |
IUPAC name | 4-methoxy-5-(3-phenylprop-2-en-1-ylidene)-5,7a-dihydro-1-benzofuran |
InChI | InChI=1S/C18H16O2/c1-19-18-15(10-11-17-16(18)12-13-20-17)9-5-8-14-6-3-2-4-7-14/h2-13,17H,1H3 |
InChIKey | HKKZOACEVJJVAR-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=CC2=CC(=CC=Cc3ccccc3)C=CC12 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Chalcones |
Total atom number | 36 |
Heavy atom number | 20 |
Bond count | 22 |
Number of carbons | 18 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.07 |
Alogp | 2.4 |
Alogp2 | 5.75 |
Apol | 43.9527 |
Bpol | 21.3233 |
EccentricConnectivityIndexDescriptor | 388 |
FmfDescriptor | 0.9 |
Fsp3 | 0.1111 |
FragmentComplexityDescriptor | 1064.02 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 889 |
Xlogp | 3.715 |
ZagrebIndex | 102 |
TopoPSA | 18.46 |