Name | (4br,10as)-9-hydroxy-7-methoxy-11,11-dimethyl-4bh,10h,10ah-benzo[b]fluoren-5-one |
Wikidata | Q105347699 |
Mol. formula | C20H20O3 |
CAS registry number | - |
Mol. weight | 308.3717 |
Temporary LOTUS id | LTS0108451 |
Name | (4br,10as)-9-hydroxy-7-methoxy-11,11-dimethyl-4bh,10h,10ah-benzo[b]fluoren-5-one |
Canonical SMILES | COc1cc(O)c2c(c1)C(=O)[C@H]1c3ccccc3C(C)(C)[C@H]1C2 |
2D SMILES | COc1cc(O)c2c(c1)C(=O)C1c3ccccc3C(C)(C)C1C2 |
IUPAC name | (4bR,10aS)-9-hydroxy-7-methoxy-11,11-dimethyl-4bH,5H,10H,10aH,11H-benzo[b]fluoren-5-one |
InChI | InChI=1S/C20H20O3/c1-20(2)15-7-5-4-6-12(15)18-16(20)10-13-14(19(18)22)8-11(23-3)9-17(13)21/h4-9,16,18,21H,10H2,1-3H3/t16-,18-/m0/s1 |
InChIKey | YFNNKWLFVPQLOR-WMZOPIPTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)CC3c4ccccc4CC3C2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Stilbenoids | Monomeric stilbenes |
Total atom number | 43 |
Heavy atom number | 23 |
Bond count | 26 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.02 |
Alogp | 3.93 |
Alogp2 | 15.45 |
Apol | 50.9419 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 386 |
FmfDescriptor | 0.7391 |
Fsp3 | 0.35 |
FragmentComplexityDescriptor | 1610.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1020 |
Xlogp | 3.779 |
ZagrebIndex | 134 |
TopoPSA | 46.53 |