Name | 3,4-dihydroxy-5-isopropyl-11,11-dimethyl-16-oxatetracyclo[6.6.2.0¹,¹⁰.0²,⁷]hexadeca-2(7),3,5-triene-9,15-dione |
Wikidata | Q105151464 |
Mol. formula | C20H24O5 |
CAS registry number | - |
Mol. weight | 344.4023 |
Temporary LOTUS id | LTS0108289 |
Name | 3,4-dihydroxy-5-isopropyl-11,11-dimethyl-16-oxatetracyclo[6.6.2.0¹,¹⁰.0²,⁷]hexadeca-2(7),3,5-triene-9,15-dione |
Canonical SMILES | CC(C)c1cc2c(c(O)c1O)C13CCCC(C)(C)C1C(=O)C2OC3=O |
2D SMILES | CC(C)c1cc2c(c(O)c1O)C13CCCC(C)(C)C1C(=O)C2OC3=O |
IUPAC name | 3,4-dihydroxy-11,11-dimethyl-5-(propan-2-yl)-16-oxatetracyclo[6.6.2.0¹,¹⁰.0²,⁷]hexadeca-2(7),3,5-triene-9,15-dione |
InChI | InChI=1S/C20H24O5/c1-9(2)10-8-11-12(14(22)13(10)21)20-7-5-6-19(3,4)17(20)15(23)16(11)25-18(20)24/h8-9,16-17,21-22H,5-7H2,1-4H3 |
InChIKey | LGMZDFRDZKIULZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC23c4ccccc4C1CC3CCCC2 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Abietane diterpenoids |
Total atom number | 49 |
Heavy atom number | 25 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.09 |
Alogp | 3.54 |
Alogp2 | 12.54 |
Apol | 55.213 |
Bpol | 30.069 |
EccentricConnectivityIndexDescriptor | 375 |
FmfDescriptor | 0.64 |
Fsp3 | 0.6 |
FragmentComplexityDescriptor | 2104.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1188 |
Xlogp | 3.839 |
ZagrebIndex | 150 |
TopoPSA | 83.83 |