Name | (1r,2r,5s,9s,10s,11r,12r,13s)-2,11,12-trihydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.0¹,¹³.0⁵,⁹]tetradecan-7-one |
Wikidata | Q105313765 |
Mol. formula | C15H20O6 |
CAS registry number | - |
Mol. weight | 296.3163 |
Temporary LOTUS id | LTS0107724 |
Name | (1r,2r,5s,9s,10s,11r,12r,13s)-2,11,12-trihydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.0¹,¹³.0⁵,⁹]tetradecan-7-one |
Canonical SMILES | C=C1C(=O)O[C@H]2[C@H]1CC[C@@](C)(O)[C@]13O[C@H]1[C@@H](O)[C@](C)(O)[C@H]23 |
2D SMILES | C=C1C(=O)OC2C1CCC(C)(O)C13OC1C(O)C(C)(O)C23 |
IUPAC name | (1R,2R,5S,9S,10S,11R,12R,13S)-2,11,12-trihydroxy-2,11-dimethyl-6-methylidene-8,14-dioxatetracyclo[8.4.0.0¹,¹³.0⁵,⁹]tetradecan-7-one |
InChI | InChI=1S/C15H20O6/c1-6-7-4-5-13(2,18)15-9(8(7)20-12(6)17)14(3,19)10(16)11(15)21-15/h7-11,16,18-19H,1,4-5H2,2-3H3/t7-,8-,9-,10+,11-,13+,14+,15+/m0/s1 |
InChIKey | WVTVTJZYCQMZFX-CQWRAAPUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCCC34OC4CCC3C12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Guaiane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 21 |
Bond count | 24 |
Number of carbons | 15 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.6 |
Alogp | -0.5 |
Alogp2 | 0.25 |
Apol | 44.5479 |
Bpol | 26.6541 |
EccentricConnectivityIndexDescriptor | 266 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1516.06 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 723 |
Xlogp | -0.316 |
ZagrebIndex | 134 |
TopoPSA | 99.52 |