Name | 3,6-dihydroxy-5-isopropyl-11,11-dimethyl-16-oxatetracyclo[6.6.2.0¹,¹⁰.0²,⁷]hexadeca-2,4,6-trien-15-one |
Wikidata | Q105161300 |
Mol. formula | C20H26O4 |
CAS registry number | - |
Mol. weight | 330.4188 |
Temporary LOTUS id | LTS0107670 |
Name | 3,6-dihydroxy-5-isopropyl-11,11-dimethyl-16-oxatetracyclo[6.6.2.0¹,¹⁰.0²,⁷]hexadeca-2,4,6-trien-15-one |
Canonical SMILES | CC(C)c1cc(O)c2c(c1O)C1CC3C(C)(C)CCCC23C(=O)O1 |
2D SMILES | CC(C)c1cc(O)c2c(c1O)C1CC3C(C)(C)CCCC23C(=O)O1 |
IUPAC name | 3,6-dihydroxy-11,11-dimethyl-5-(propan-2-yl)-16-oxatetracyclo[6.6.2.0¹,¹⁰.0²,⁷]hexadeca-2,4,6-trien-15-one |
InChI | InChI=1S/C20H26O4/c1-10(2)11-8-12(21)16-15(17(11)22)13-9-14-19(3,4)6-5-7-20(14,16)18(23)24-13/h8,10,13-14,21-22H,5-7,9H2,1-4H3 |
InChIKey | MCMQSPNBTJWIEO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC23c4ccccc4C1CC3CCCC2 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Abietane diterpenoids |
Total atom number | 50 |
Heavy atom number | 24 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.07 |
Alogp | 4.34 |
Alogp2 | 18.81 |
Apol | 55.7446 |
Bpol | 31.2974 |
EccentricConnectivityIndexDescriptor | 362 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.65 |
FragmentComplexityDescriptor | 2257.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1080 |
Xlogp | 5.37 |
ZagrebIndex | 144 |
TopoPSA | 66.76 |