Name | 5,9,17-trimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.0²,⁶.0⁷,¹¹.0¹³,¹⁸]icosa-1(20),2(6),4,7(11),9,12,14,16,18-nonaene |
Wikidata | Q105121255 |
Mol. formula | C20H15NO2 |
CAS registry number | - |
Mol. weight | 301.3393 |
Temporary LOTUS id | LTS0106867 |
Name | 5,9,17-trimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.0²,⁶.0⁷,¹¹.0¹³,¹⁸]icosa-1(20),2(6),4,7(11),9,12,14,16,18-nonaene |
Canonical SMILES | Cc1nc2c(o1)c1c(C)coc1c1ccc3c(C)cccc3c12 |
2D SMILES | Cc1nc2c(o1)c1c(C)coc1c1ccc3c(C)cccc3c12 |
IUPAC name | 5,9,17-trimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.0²,⁶.0⁷,¹¹.0¹³,¹⁸]icosa-1(20),2(6),4,7(11),9,12,14,16,18-nonaene |
InChI | InChI=1S/C20H15NO2/c1-10-5-4-6-14-13(10)7-8-15-17(14)18-20(23-12(3)21-18)16-11(2)9-22-19(15)16/h4-9H,1-3H3 |
InChIKey | IVRVVMSJCWUYKG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | n1coc2c1c3c4ccccc4ccc3c5occc25 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Furanoabietane diterpenoids |
Total atom number | 38 |
Heavy atom number | 23 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 17 |
NP-likeness score | 1 |
Alogp | 4.75 |
Alogp2 | 22.57 |
Apol | 47.9059 |
Bpol | 21.5501 |
EccentricConnectivityIndexDescriptor | 366 |
FmfDescriptor | 0.8696 |
Fsp3 | 0.15 |
FragmentComplexityDescriptor | 1258.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 990 |
Xlogp | 4.636 |
ZagrebIndex | 138 |
TopoPSA | 39.17 |