Name | 5,7-dihydroxy-4a,8-dimethyl-3-methylidene-octahydro-3ah-azuleno[6,5-b]furan-2-one |
Wikidata | Q82929160 |
Mol. formula | C15H22O4 |
CAS registry number | - |
Mol. weight | 266.3334 |
Temporary LOTUS id | LTS0106699 |
Name | 5,7-dihydroxy-4a,8-dimethyl-3-methylidene-octahydro-3ah-azuleno[6,5-b]furan-2-one |
Canonical SMILES | C=C1C(=O)OC2CC(C)C3C(O)CC(O)C3(C)CC12 |
2D SMILES | C=C1C(=O)OC2CC(C)C3C(O)CC(O)C3(C)CC12 |
IUPAC name | 5,7-dihydroxy-4a,8-dimethyl-3-methylidene-dodecahydroazuleno[6,5-b]furan-2-one |
InChI | InChI=1S/C15H22O4/c1-7-4-11-9(8(2)14(18)19-11)6-15(3)12(17)5-10(16)13(7)15/h7,9-13,16-17H,2,4-6H2,1,3H3 |
InChIKey | BPUNWVGCTMEMKQ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC3CCCC3CCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Pseudoguaiane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 19 |
Bond count | 21 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 0.98 |
Alogp | 1.17 |
Alogp2 | 1.36 |
Apol | 44.2774 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 247 |
FmfDescriptor | 0.6842 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1507.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 586 |
Xlogp | 1.276 |
ZagrebIndex | 110 |
TopoPSA | 66.76 |