Name | 4-allylpyrocatechol |
Wikidata | Q72437390 |
Mol. formula | C9H10O2 |
CAS registry number | - |
Mol. weight | 150.1748 |
Temporary LOTUS id | LTS0106385 |
Name | 4-allylpyrocatechol |
Canonical SMILES | C=CCc1ccc(O)c(O)c1 |
2D SMILES | C=CCc1ccc(O)c(O)c1 |
IUPAC name | 4-(prop-2-en-1-yl)benzene-1,2-diol |
InChI | InChI=1S/C9H10O2/c1-2-3-7-4-5-8(10)9(11)6-7/h2,4-6,10-11H,1,3H2 |
InChIKey | FHEHIXJLCWUPCZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 21 |
Heavy atom number | 11 |
Bond count | 11 |
Number of carbons | 9 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 2.3 |
Alogp2 | 5.3 |
Apol | 24.1119 |
Bpol | 10.9321 |
EccentricConnectivityIndexDescriptor | 113 |
FmfDescriptor | 0.5455 |
Fsp3 | 0.1111 |
FragmentComplexityDescriptor | 331.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 160 |
Xlogp | 2.664 |
ZagrebIndex | 50 |
TopoPSA | 40.46 |