Name | 1-hydroxy-2-[(2s)-1-hydroxypropan-2-yl]-8,8-dimethyl-6,7-dihydro-5h-phenanthrene-3,4-dione |
Wikidata | Q104397237 |
Mol. formula | C19H22O4 |
CAS registry number | - |
Mol. weight | 314.3763 |
Temporary LOTUS id | LTS0105767 |
Name | 1-hydroxy-2-[(2s)-1-hydroxypropan-2-yl]-8,8-dimethyl-6,7-dihydro-5h-phenanthrene-3,4-dione |
Canonical SMILES | C[C@H](CO)C1=C(O)c2ccc3c(c2C(=O)C1=O)CCCC3(C)C |
2D SMILES | CC(CO)C1=C(O)c2ccc3c(c2C(=O)C1=O)CCCC3(C)C |
IUPAC name | 1-hydroxy-2-[(2S)-1-hydroxypropan-2-yl]-8,8-dimethyl-3,4,5,6,7,8-hexahydrophenanthrene-3,4-dione |
InChI | InChI=1S/C19H22O4/c1-10(9-20)14-16(21)12-6-7-13-11(5-4-8-19(13,2)3)15(12)18(23)17(14)22/h6-7,10,20-21H,4-5,8-9H2,1-3H3/t10-/m1/s1 |
InChIKey | LGZFJHSOBYVDLA-SNVBAGLBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1cc2c(c3c1C=CCC3)CCCC2 |
Pathway | Superclass | Class |
Polyketides | Naphthalenes | Naphthoquinones |
Total atom number | 45 |
Heavy atom number | 23 |
Bond count | 25 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.46 |
Alogp | 3.01 |
Alogp2 | 9.08 |
Apol | 51.3174 |
Bpol | 25.9666 |
EccentricConnectivityIndexDescriptor | 367 |
FmfDescriptor | 0.6087 |
Fsp3 | 0.4737 |
FragmentComplexityDescriptor | 1703.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1042 |
Xlogp | 3.332 |
ZagrebIndex | 128 |
TopoPSA | 74.6 |