Name | Butyl 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
Wikidata | Q104990332 |
Mol. formula | C12H16O4 |
CAS registry number | - |
Mol. weight | 224.2535 |
Temporary LOTUS id | LTS0104786 |
Name | Butyl 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
Canonical SMILES | CCCCOC(=O)CC1(O)C=CC(=O)C=C1 |
2D SMILES | CCCCOC(=O)CC1(O)C=CC(=O)C=C1 |
IUPAC name | butyl 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
InChI | InChI=1S/C12H16O4/c1-2-3-8-16-11(14)9-12(15)6-4-10(13)5-7-12/h4-7,15H,2-3,8-9H2,1H3 |
InChIKey | DVSNLDWAUDAFNG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCC=CC1 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 32 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 12 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.45 |
Alogp | 1.3 |
Alogp2 | 1.69 |
Apol | 34.9967 |
Bpol | 21.3233 |
EccentricConnectivityIndexDescriptor | 261 |
FmfDescriptor | 0.375 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 784.04 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 501 |
Xlogp | 1.373 |
ZagrebIndex | 74 |
TopoPSA | 63.6 |