Name | Methyl (1r,15r,16r,20r)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹⁰.0⁴,⁹.0¹⁵,²⁰]henicosa-2(10),4,6,8,18-pentaene-19-carboxylate |
Wikidata | Q105016453 |
Mol. formula | C21H24N2O3 |
CAS registry number | - |
Mol. weight | 352.4277 |
Temporary LOTUS id | LTS0104674 |
Name | Methyl (1r,15r,16r,20r)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹⁰.0⁴,⁹.0¹⁵,²⁰]henicosa-2(10),4,6,8,18-pentaene-19-carboxylate |
Canonical SMILES | COC(=O)C1=CO[C@H](C)[C@H]2CN3CCc4c([nH]c5ccccc45)[C@H]3C[C@@H]12 |
2D SMILES | COC(=O)C1=COC(C)C2CN3CCc4c([nH]c5ccccc45)C3CC12 |
IUPAC name | methyl (1R,15R,16R,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹⁰.0⁴,⁹.0¹⁵,²⁰]henicosa-2(10),4,6,8,18-pentaene-19-carboxylate |
InChI | InChI=1S/C21H24N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-6,11-12,15-16,19,22H,7-10H2,1-2H3/t12-,15-,16-,19-/m1/s1 |
InChIKey | GRTOGORTSDXSFK-BGIGGGFGSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=CC2CC3c4[nH]c5ccccc5c4CCN3CC2C1 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Corynanthe type |
Total atom number | 50 |
Heavy atom number | 26 |
Bond count | 30 |
Number of carbons | 21 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 0.98 |
Alogp | 2.66 |
Alogp2 | 7.1 |
Apol | 57.569 |
Bpol | 33.667 |
EccentricConnectivityIndexDescriptor | 510 |
FmfDescriptor | 0.8077 |
Fsp3 | 0.4762 |
FragmentComplexityDescriptor | 2266.05 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1517 |
Xlogp | 2.934 |
ZagrebIndex | 150 |
TopoPSA | 54.56 |