Name | (2r,3s)-2,3-bis(2h-1,3-benzodioxol-5-ylmethyl)butane-1,4-diol |
Wikidata | Q105130148 |
Mol. formula | C20H22O6 |
CAS registry number | - |
Mol. weight | 358.3858 |
Temporary LOTUS id | LTS0104478 |
Name | (2r,3s)-2,3-bis(2h-1,3-benzodioxol-5-ylmethyl)butane-1,4-diol |
Canonical SMILES | OC[C@@H](Cc1ccc2c(c1)OCO2)[C@H](CO)Cc1ccc2c(c1)OCO2 |
2D SMILES | OCC(Cc1ccc2c(c1)OCO2)C(CO)Cc1ccc2c(c1)OCO2 |
IUPAC name | (2R,3S)-2,3-bis[(2H-1,3-benzodioxol-5-yl)methyl]butane-1,4-diol |
InChI | InChI=1S/C20H22O6/c21-9-15(5-13-1-3-17-19(7-13)25-11-23-17)16(10-22)6-14-2-4-18-20(8-14)26-12-24-18/h1-4,7-8,15-16,21-22H,5-6,9-12H2/t15-,16+ |
InChIKey | JKCVMTYNARDGET-IYBDPMFKSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)CCCCc3ccc4OCOc4c3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Arylnaphthalene and aryltetralin lignans |
Total atom number | 48 |
Heavy atom number | 26 |
Bond count | 29 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 2.9 |
Alogp2 | 8.39 |
Apol | 54.6814 |
Bpol | 31.7146 |
EccentricConnectivityIndexDescriptor | 592 |
FmfDescriptor | 0.8462 |
Fsp3 | 0.4 |
FragmentComplexityDescriptor | 1951.06 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1779 |
Xlogp | 2.238 |
ZagrebIndex | 138 |
TopoPSA | 77.38 |