Name | 8,11-dihydroxy-12-(4-hydroxyphenyl)-4-(2-hydroxypropan-2-yl)-5,13-dioxatricyclo[7.4.0.0²,⁶]trideca-1(9),2(6),7-trien-10-one |
Wikidata | Q105151114 |
Mol. formula | C20H20O7 |
CAS registry number | - |
Mol. weight | 372.3694 |
Temporary LOTUS id | LTS0102623 |
Name | 8,11-dihydroxy-12-(4-hydroxyphenyl)-4-(2-hydroxypropan-2-yl)-5,13-dioxatricyclo[7.4.0.0²,⁶]trideca-1(9),2(6),7-trien-10-one |
Canonical SMILES | CC(C)(O)C1Cc2c(cc(O)c3c2OC(c2ccc(O)cc2)C(O)C3=O)O1 |
2D SMILES | CC(C)(O)C1Cc2c(cc(O)c3c2OC(c2ccc(O)cc2)C(O)C3=O)O1 |
IUPAC name | 8,11-dihydroxy-12-(4-hydroxyphenyl)-4-(2-hydroxypropan-2-yl)-5,13-dioxatricyclo[7.4.0.0²,⁶]trideca-1(9),2(6),7-trien-10-one |
InChI | InChI=1S/C20H20O7/c1-20(2,25)14-7-11-13(26-14)8-12(22)15-16(23)17(24)18(27-19(11)15)9-3-5-10(21)6-4-9/h3-6,8,14,17-18,21-22,24-25H,7H2,1-2H3 |
InChIKey | LFOTZGWNITYXGY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc3c(OC(c4ccccc4)CC3)c2CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Dihydroflavonols |
Total atom number | 47 |
Heavy atom number | 27 |
Bond count | 30 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.26 |
Alogp | 2.15 |
Alogp2 | 4.62 |
Apol | 54.1499 |
Bpol | 26.6541 |
EccentricConnectivityIndexDescriptor | 541 |
FmfDescriptor | 0.7037 |
Fsp3 | 0.35 |
FragmentComplexityDescriptor | 1798.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1704 |
Xlogp | 2.066 |
ZagrebIndex | 154 |
TopoPSA | 116.45 |