Name | Ichthyothereol |
Wikidata | Q15133281 |
Mol. formula | C14H14O2 |
CAS registry number | - |
Mol. weight | 214.2603 |
Temporary LOTUS id | LTS0100904 |
Name | Ichthyothereol |
Canonical SMILES | CC#CC#CC#C/C=C/[C@@H]1OCCC[C@H]1O |
2D SMILES | CC#CC#CC#CC=CC1OCCCC1O |
IUPAC name | (2S,3R)-2-[(1E)-non-1-en-3,5,7-triyn-1-yl]oxan-3-ol |
InChI | InChI=1S/C14H14O2/c1-2-3-4-5-6-7-8-11-14-13(15)10-9-12-16-14/h8,11,13-15H,9-10,12H2,1H3/b11-8+/t13-,14+/m1/s1 |
InChIKey | WFJPISZWZQHNLX-GELOPOQCSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCCCC1 |
Pathway | Superclass | Class |
Fatty acids | Fatty acyls | Fatty alcohols |
Total atom number | 30 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 14 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 2.82 |
Alogp2 | 7.95 |
Apol | 35.5791 |
Bpol | 17.2209 |
EccentricConnectivityIndexDescriptor | 300 |
FmfDescriptor | 0.375 |
Fsp3 | 0.4286 |
FragmentComplexityDescriptor | 660.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 576 |
Xlogp | 2.746 |
ZagrebIndex | 68 |
TopoPSA | 29.46 |